About N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide
N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide (PubChem CID 3254185) has the molecular formula C22H28N2O2
and a molecular weight of 352.48 g/mol. Its IUPAC name is N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide.
Molecular Properties
| Compound Name | N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide |
| PubChem CID | 3254185 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide |
| SMILES | CC(C)c1ccc(NC(=O)CCCC(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-17(2)19-11-13-20(14-12-19)24-22(26)10-6-9-21(25)23-16-15-18-7-4-3-5-8-18/h3-5,7-8,11-14,17H,6,9-10,15-16H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | ASJKRVNZEUMMAV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide?
The IUPAC name of N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide (CID 3254185) is N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide.
What is the SMILES notation for N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide?
The canonical SMILES for N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide is CC(C)c1ccc(NC(=O)CCCC(=O)NCCc2ccccc2)cc1.
What is the InChIKey of N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide?
The InChIKey is ASJKRVNZEUMMAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O2/c1-17(2)19-11-13-20(14-12-19)24-22(26)10-6-9-21(25)23-16-15-18-7-4-3-5-8-18/h3-5,7-8,11-14,17H,6,9-10,15-16H2,1-2H3,(H,23,25)(H,24,26).
What are the key properties of N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide?
N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide has a molecular weight of 352.48 g/mol, XLogP of 4.28, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-phenylethyl)-N'-(4-propan-2-ylphenyl)pentanediamide is sourced from PubChem (CID 3254185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).