About 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one
4-benzoyl-2-phenyl-1,4-benzoxazin-3-one (PubChem CID 3254714) has the molecular formula C21H15NO3
and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one |
| PubChem CID | 3254714 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one |
| SMILES | O=C(c1ccccc1)N1C(=O)C(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C21H15NO3/c23-20(16-11-5-2-6-12-16)22-17-13-7-8-14-18(17)25-19(21(22)24)15-9-3-1-4-10-15/h1-14,19H |
| InChIKey | SKUGMJYGUNVEJD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one?
The IUPAC name of 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one (CID 3254714) is 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one?
The canonical SMILES for 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one is O=C(c1ccccc1)N1C(=O)C(c2ccccc2)Oc2ccccc21.
What is the InChIKey of 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one?
The InChIKey is SKUGMJYGUNVEJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15NO3/c23-20(16-11-5-2-6-12-16)22-17-13-7-8-14-18(17)25-19(21(22)24)15-9-3-1-4-10-15/h1-14,19H.
What are the key properties of 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one?
4-benzoyl-2-phenyl-1,4-benzoxazin-3-one has a molecular weight of 329.36 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzoyl-2-phenyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 3254714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).