C12H15NO5 — CID 3254722
4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)butanoic acid (PubChem CID 3254722) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)butanoic acid.
| Compound Name | 4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 3254722 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C12H15NO5/c14-8(15)2-1-5-13-11(16)9-6-3-4-7(18-6)10(9)12(13)17/h6-7,9-10H,1-5H2,(H,14,15) |
| InChIKey | FOHSNFBJZWGBMS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|