C26H20N4O4S2 — CID 3255213
5-(3-hydroxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione (PubChem CID 3255213) has the molecular formula C26H20N4O4S2 and a molecular weight of 516.60 g/mol. Its IUPAC name is 5-(3-hydroxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione.
| Compound Name | 5-(3-hydroxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3255213 |
| Molecular Formula | C26H20N4O4S2 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 5-(3-hydroxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(CSc2nnc(N3C(=O)C(=O)C(=C(O)c4ccncc4)C3c3cccc(O)c3)s2)cc1 |
| InChI | InChI=1S/C26H20N4O4S2/c1-15-5-7-16(8-6-15)14-35-26-29-28-25(36-26)30-21(18-3-2-4-19(31)13-18)20(23(33)24(30)34)22(32)17-9-11-27-12-10-17/h2-13,21,31-32H,14H2,1H3 |
| InChIKey | KLACCHMVTVHHLW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|