About 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione
1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione (PubChem CID 3255295) has the molecular formula C25H29FN2O4
and a molecular weight of 440.52 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione |
| PubChem CID | 3255295 |
| Molecular Formula | C25H29FN2O4 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione |
| SMILES | COc1ccc(C2C(=O)N(C3CCCCC3)CC(=O)N2Cc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C25H29FN2O4/c1-31-21-13-10-18(14-22(21)32-2)24-25(30)27(20-6-4-3-5-7-20)16-23(29)28(24)15-17-8-11-19(26)12-9-17/h8-14,20,24H,3-7,15-16H2,1-2H3 |
| InChIKey | PKGLGTCULAVGSX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione?
The IUPAC name of 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione (CID 3255295) is 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione.
What is the SMILES notation for 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione?
The canonical SMILES for 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione is COc1ccc(C2C(=O)N(C3CCCCC3)CC(=O)N2Cc2ccc(F)cc2)cc1OC.
What is the InChIKey of 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione?
The InChIKey is PKGLGTCULAVGSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29FN2O4/c1-31-21-13-10-18(14-22(21)32-2)24-25(30)27(20-6-4-3-5-7-20)16-23(29)28(24)15-17-8-11-19(26)12-9-17/h8-14,20,24H,3-7,15-16H2,1-2H3.
What are the key properties of 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione?
1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione has a molecular weight of 440.52 g/mol, XLogP of 4.09, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,5-dione is sourced from PubChem (CID 3255295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).