About N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide
N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide (PubChem CID 3255608) has the molecular formula C28H21N5O3
and a molecular weight of 475.51 g/mol. Its IUPAC name is N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide.
Molecular Properties
| Compound Name | N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide |
| PubChem CID | 3255608 |
| Molecular Formula | C28H21N5O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1ccccc1Nc1cc(-c2ccccc2)nn1-c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H21N5O3/c34-28(21-15-17-23(18-16-21)33(35)36)30-25-14-8-7-13-24(25)29-27-19-26(20-9-3-1-4-10-20)31-32(27)22-11-5-2-6-12-22/h1-19,29H,(H,30,34) |
| InChIKey | CKCJBNZFKKVVNZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide?
The IUPAC name of N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide (CID 3255608) is N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide.
What is the SMILES notation for N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide?
The canonical SMILES for N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide is O=C(Nc1ccccc1Nc1cc(-c2ccccc2)nn1-c1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide?
The InChIKey is CKCJBNZFKKVVNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H21N5O3/c34-28(21-15-17-23(18-16-21)33(35)36)30-25-14-8-7-13-24(25)29-27-19-26(20-9-3-1-4-10-20)31-32(27)22-11-5-2-6-12-22/h1-19,29H,(H,30,34).
What are the key properties of N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide?
N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide has a molecular weight of 475.51 g/mol, XLogP of 6.44, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-nitrobenzamide is sourced from PubChem (CID 3255608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).