C24H30N2O3S2 — CID 32559118
N-(2-cyclopentylsulfanylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 32559118) has the molecular formula C24H30N2O3S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-cyclopentylsulfanylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 32559118 |
| Molecular Formula | C24H30N2O3S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-(2-cyclopentylsulfanylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3ccccc3SC3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O3S2/c1-18-10-12-21(13-11-18)31(28,29)26-16-14-19(15-17-26)24(27)25-22-8-4-5-9-23(22)30-20-6-2-3-7-20/h4-5,8-13,19-20H,2-3,6-7,14-17H2,1H3,(H,25,27) |
| InChIKey | XSDLDMQZSXDUPA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |