C17H22N5O2+ — CID 3256160
[acetamido-(2-ethoxyanilino)methylidene]-(4,6-dimethylpyrimidin-2-yl)azanium (PubChem CID 3256160) has the molecular formula C17H22N5O2+ and a molecular weight of 328.40 g/mol. Its IUPAC name is [acetamido-(2-ethoxyanilino)methylidene]-(4,6-dimethylpyrimidin-2-yl)azanium.
| Compound Name | [acetamido-(2-ethoxyanilino)methylidene]-(4,6-dimethylpyrimidin-2-yl)azanium |
|---|---|
| PubChem CID | 3256160 |
| Molecular Formula | C17H22N5O2+ |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | [acetamido-(2-ethoxyanilino)methylidene]-(4,6-dimethylpyrimidin-2-yl)azanium |
| SMILES | CCOc1ccccc1NC(NC(C)=O)=[NH+]c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C17H21N5O2/c1-5-24-15-9-7-6-8-14(15)21-17(20-13(4)23)22-16-18-11(2)10-12(3)19-16/h6-10H,5H2,1-4H3,(H2,18,19,20,21,22,23)/p+1 |
| InChIKey | QTYCBKHVAWOSJP-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|