C22H27N3O — CID 3256438
6,7,12,15,15-pentamethyl-N-prop-2-enyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide (PubChem CID 3256438) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 6,7,12,15,15-pentamethyl-N-prop-2-enyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide.
| Compound Name | 6,7,12,15,15-pentamethyl-N-prop-2-enyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 3256438 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 6,7,12,15,15-pentamethyl-N-prop-2-enyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide |
| SMILES | C=CCNC(=O)C12CCC(C)(c3nc4cc(C)c(C)cc4nc31)C2(C)C |
| InChI | InChI=1S/C22H27N3O/c1-7-10-23-19(26)22-9-8-21(6,20(22,4)5)17-18(22)25-16-12-14(3)13(2)11-15(16)24-17/h7,11-12H,1,8-10H2,2-6H3,(H,23,26) |
| InChIKey | OMGKLJMCZSBLHA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|