C19H23NO2 — CID 32564607
N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-2-(4-methylphenoxy)acetamide (PubChem CID 32564607) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 32564607 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-2-(4-methylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)N[C@@H](C)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-13-6-9-17(10-7-13)22-12-19(21)20-16(4)18-11-14(2)5-8-15(18)3/h5-11,16H,12H2,1-4H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | IQXJCHUKQKSVTC-INIZCTEOSA-N |
| XLogP | 3.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |