C28H23Br2N3O2S — CID 3257233
5-(5,7-dibromo-1-methyl-2-oxoindol-3-ylidene)-3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 3257233) has the molecular formula C28H23Br2N3O2S and a molecular weight of 625.39 g/mol. Its IUPAC name is 5-(5,7-dibromo-1-methyl-2-oxoindol-3-ylidene)-3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-(5,7-dibromo-1-methyl-2-oxoindol-3-ylidene)-3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3257233 |
| Molecular Formula | C28H23Br2N3O2S |
| Molecular Weight | 625.39 g/mol |
| Exact Mass | 622.99 |
| IUPAC Name | 5-(5,7-dibromo-1-methyl-2-oxoindol-3-ylidene)-3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\SC(=C3C(=O)N(C)c4c(Br)cc(Br)cc43)C(=O)N2c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C28H23Br2N3O2S/c1-14-6-8-19(10-16(14)3)31-28-33(20-9-7-15(2)17(4)11-20)27(35)25(36-28)23-21-12-18(29)13-22(30)24(21)32(5)26(23)34/h6-13H,1-5H3/b25-23?,31-28- |
| InChIKey | NVVQZFGVLFMZRE-YHHCNAHLSA-N |
| XLogP | 7.60 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.39 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|