About (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium
(3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium (PubChem CID 3257478) has the molecular formula C30H24O2P+
and a molecular weight of 447.49 g/mol. Its IUPAC name is (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium.
Molecular Properties
| Compound Name | (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium |
| PubChem CID | 3257478 |
| Molecular Formula | C30H24O2P+ |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium |
| SMILES | CC1=C(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H24O2P/c1-22-28(30(32)27-20-12-11-19-26(27)29(22)31)21-33(23-13-5-2-6-14-23,24-15-7-3-8-16-24)25-17-9-4-10-18-25/h2-20H,21H2,1H3/q+1 |
| InChIKey | NIGYKKXICQUSEM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium?
The IUPAC name of (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium (CID 3257478) is (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium.
What is the SMILES notation for (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium?
The canonical SMILES for (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium is CC1=C(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)c2ccccc2C1=O.
What is the InChIKey of (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium?
The InChIKey is NIGYKKXICQUSEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24O2P/c1-22-28(30(32)27-20-12-11-19-26(27)29(22)31)21-33(23-13-5-2-6-14-23,24-15-7-3-8-16-24)25-17-9-4-10-18-25/h2-20H,21H2,1H3/q+1.
What are the key properties of (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium?
(3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium has a molecular weight of 447.49 g/mol, XLogP of 5.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,4-dioxonaphthalen-2-yl)methyl-triphenylphosphanium is sourced from PubChem (CID 3257478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).