C12H8N2O10S2 — CID 3257804
2-[2-(carboxymethyl)-1,1,3,5,7,7-hexaoxo-[1,2]thiazolo[4,5-f][1,2]benzothiazol-6-yl]acetic acid (PubChem CID 3257804) has the molecular formula C12H8N2O10S2 and a molecular weight of 404.33 g/mol. Its IUPAC name is 2-[2-(carboxymethyl)-1,1,3,5,7,7-hexaoxo-[1,2]thiazolo[4,5-f][1,2]benzothiazol-6-yl]acetic acid.
| Compound Name | 2-[2-(carboxymethyl)-1,1,3,5,7,7-hexaoxo-[1,2]thiazolo[4,5-f][1,2]benzothiazol-6-yl]acetic acid |
|---|---|
| PubChem CID | 3257804 |
| Molecular Formula | C12H8N2O10S2 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | 2-[2-(carboxymethyl)-1,1,3,5,7,7-hexaoxo-[1,2]thiazolo[4,5-f][1,2]benzothiazol-6-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)c2cc3c(cc2S1(=O)=O)S(=O)(=O)N(CC(=O)O)C3=O |
| InChI | InChI=1S/C12H8N2O10S2/c15-9(16)3-13-11(19)5-1-6-8(2-7(5)25(13,21)22)26(23,24)14(12(6)20)4-10(17)18/h1-2H,3-4H2,(H,15,16)(H,17,18) |
| InChIKey | NSWHGJVEBFFGAV-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 183.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |