C20H40N4O2 — CID 3258490
N-[3-[4-[3-(2,2-dimethylpropanoylamino)propyl]piperazin-1-yl]propyl]-2,2-dimethylpropanamide (PubChem CID 3258490) has the molecular formula C20H40N4O2 and a molecular weight of 368.57 g/mol. Its IUPAC name is N-[3-[4-[3-(2,2-dimethylpropanoylamino)propyl]piperazin-1-yl]propyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[4-[3-(2,2-dimethylpropanoylamino)propyl]piperazin-1-yl]propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 3258490 |
| Molecular Formula | C20H40N4O2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.32 |
| IUPAC Name | N-[3-[4-[3-(2,2-dimethylpropanoylamino)propyl]piperazin-1-yl]propyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCN1CCN(CCCNC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H40N4O2/c1-19(2,3)17(25)21-9-7-11-23-13-15-24(16-14-23)12-8-10-22-18(26)20(4,5)6/h7-16H2,1-6H3,(H,21,25)(H,22,26) |
| InChIKey | IUGOBJZYBODIRT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|