C24H25N3O4S — CID 3258706
5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-(4-ethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 3258706) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is 5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-(4-ethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-(4-ethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 3258706 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-(4-ethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CCCCOc1ccc(C=c2sc3nc(-c4ccc(OCC)cc4)nn3c2=O)cc1OC |
| InChI | InChI=1S/C24H25N3O4S/c1-4-6-13-31-19-12-7-16(14-20(19)29-3)15-21-23(28)27-24(32-21)25-22(26-27)17-8-10-18(11-9-17)30-5-2/h7-12,14-15H,4-6,13H2,1-3H3 |
| InChIKey | QPURNTBJKFLQOO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|