C18H24N4O2S2 — CID 3259125
methyl 2-(3-imidazol-1-ylpropylcarbamothioylamino)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3259125) has the molecular formula C18H24N4O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is methyl 2-(3-imidazol-1-ylpropylcarbamothioylamino)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-(3-imidazol-1-ylpropylcarbamothioylamino)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3259125 |
| Molecular Formula | C18H24N4O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | methyl 2-(3-imidazol-1-ylpropylcarbamothioylamino)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NCCCn2ccnc2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C18H24N4O2S2/c1-12-4-5-13-14(10-12)26-16(15(13)17(23)24-2)21-18(25)20-6-3-8-22-9-7-19-11-22/h7,9,11-12H,3-6,8,10H2,1-2H3,(H2,20,21,25) |
| InChIKey | MVUYVSOPAOCKLW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|