C16H26N4O2S2 — CID 3259305
1-(4-sulfamoylphenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 3259305) has the molecular formula C16H26N4O2S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-(4-sulfamoylphenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 3259305 |
| Molecular Formula | C16H26N4O2S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-(4-sulfamoylphenyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CC1(C)CC(NC(=S)Nc2ccc(S(N)(=O)=O)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C16H26N4O2S2/c1-15(2)9-12(10-16(3,4)20-15)19-14(23)18-11-5-7-13(8-6-11)24(17,21)22/h5-8,12,20H,9-10H2,1-4H3,(H2,17,21,22)(H2,18,19,23) |
| InChIKey | MLCTVWZUKLXYRL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|