About 1-chloro-3,5-dimethyladamantane
1-chloro-3,5-dimethyladamantane (PubChem CID 3259679) has the molecular formula C12H19Cl
and a molecular weight of 198.74 g/mol. Its IUPAC name is 1-chloro-3,5-dimethyladamantane.
Molecular Properties
| Compound Name | 1-chloro-3,5-dimethyladamantane |
| PubChem CID | 3259679 |
| Molecular Formula | C12H19Cl |
| Molecular Weight | 198.74 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-chloro-3,5-dimethyladamantane |
| SMILES | CC12CC3CC(C)(C1)CC(Cl)(C3)C2 |
| InChI | InChI=1S/C12H19Cl/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8H2,1-2H3 |
| InChIKey | PXDRFQZLDWZHPX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3,5-dimethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3,5-dimethyladamantane?
The IUPAC name of 1-chloro-3,5-dimethyladamantane (CID 3259679) is 1-chloro-3,5-dimethyladamantane.
What is the SMILES notation for 1-chloro-3,5-dimethyladamantane?
The canonical SMILES for 1-chloro-3,5-dimethyladamantane is CC12CC3CC(C)(C1)CC(Cl)(C3)C2.
What is the InChIKey of 1-chloro-3,5-dimethyladamantane?
The InChIKey is PXDRFQZLDWZHPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19Cl/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8H2,1-2H3.
What are the key properties of 1-chloro-3,5-dimethyladamantane?
1-chloro-3,5-dimethyladamantane has a molecular weight of 198.74 g/mol, XLogP of 3.97, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3,5-dimethyladamantane is sourced from PubChem (CID 3259679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).