C15H27N3O3S — CID 3259781
N-cyclopentyl-1-pyrrolidin-1-ylsulfonylpiperidine-3-carboxamide (PubChem CID 3259781) has the molecular formula C15H27N3O3S and a molecular weight of 329.47 g/mol. Its IUPAC name is N-cyclopentyl-1-pyrrolidin-1-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-cyclopentyl-1-pyrrolidin-1-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3259781 |
| Molecular Formula | C15H27N3O3S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | N-cyclopentyl-1-pyrrolidin-1-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCCC1)C1CCCN(S(=O)(=O)N2CCCC2)C1 |
| InChI | InChI=1S/C15H27N3O3S/c19-15(16-14-7-1-2-8-14)13-6-5-11-18(12-13)22(20,21)17-9-3-4-10-17/h13-14H,1-12H2,(H,16,19) |
| InChIKey | QXCBUBDLSWAYCG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |