C18H30NO3+ — CID 3259886
(8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl)methyl-trimethylazanium (PubChem CID 3259886) has the molecular formula C18H30NO3+ and a molecular weight of 308.44 g/mol. Its IUPAC name is (8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl)methyl-trimethylazanium.
| Compound Name | (8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl)methyl-trimethylazanium |
|---|---|
| PubChem CID | 3259886 |
| Molecular Formula | C18H30NO3+ |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl)methyl-trimethylazanium |
| SMILES | CC1CCC2C(C[N+](C)(C)C)C(=O)OC23C1CCC1(C)OC13 |
| InChI | InChI=1S/C18H30NO3/c1-11-6-7-14-12(10-19(3,4)5)15(20)21-18(14)13(11)8-9-17(2)16(18)22-17/h11-14,16H,6-10H2,1-5H3/q+1 |
| InChIKey | SNGWWISTWVXYJT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|