C20H16FN3O2S — CID 32601711
1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 32601711) has the molecular formula C20H16FN3O2S and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 32601711 |
| Molecular Formula | C20H16FN3O2S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | O=C(c1ccn(-c2ccc(F)cc2)n1)N(Cc1ccco1)Cc1cccs1 |
| InChI | InChI=1S/C20H16FN3O2S/c21-15-5-7-16(8-6-15)24-10-9-19(22-24)20(25)23(13-17-3-1-11-26-17)14-18-4-2-12-27-18/h1-12H,13-14H2 |
| InChIKey | VUQFWVVLAGABJF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |