About 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene
4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 3260194) has the molecular formula C16H19NO2S
and a molecular weight of 289.40 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| PubChem CID | 3260194 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3C4C=CC(C4)C3C2)cc1 |
| InChI | InChI=1S/C16H19NO2S/c1-11-2-6-14(7-3-11)20(18,19)17-9-15-12-4-5-13(8-12)16(15)10-17/h2-7,12-13,15-16H,8-10H2,1H3 |
| InChIKey | LFHXOTNXYXWNSX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The IUPAC name of 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene (CID 3260194) is 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene.
What is the SMILES notation for 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The canonical SMILES for 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene is Cc1ccc(S(=O)(=O)N2CC3C4C=CC(C4)C3C2)cc1.
What is the InChIKey of 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The InChIKey is LFHXOTNXYXWNSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S/c1-11-2-6-14(7-3-11)20(18,19)17-9-15-12-4-5-13(8-12)16(15)10-17/h2-7,12-13,15-16H,8-10H2,1H3.
What are the key properties of 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene has a molecular weight of 289.40 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)sulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene is sourced from PubChem (CID 3260194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).