About (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide
(3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 32602078) has the molecular formula C13H21N5O2
and a molecular weight of 279.34 g/mol. Its IUPAC name is (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide |
| PubChem CID | 32602078 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | CN(Cc1cnn(C)c1)C(=O)[C@H]1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C13H21N5O2/c1-16(7-10-6-15-17(2)8-10)12(19)11-4-3-5-18(9-11)13(14)20/h6,8,11H,3-5,7,9H2,1-2H3,(H2,14,20)/t11-/m0/s1 |
| InChIKey | WAUQQTLEZGUKSD-NSHDSACASA-N |
| XLogP | 0.17 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide?
The IUPAC name of (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide (CID 32602078) is (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide.
What is the SMILES notation for (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide?
The canonical SMILES for (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide is CN(Cc1cnn(C)c1)C(=O)[C@H]1CCCN(C(N)=O)C1.
What is the InChIKey of (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide?
The InChIKey is WAUQQTLEZGUKSD-NSHDSACASA-N. The full InChI is InChI=1S/C13H21N5O2/c1-16(7-10-6-15-17(2)8-10)12(19)11-4-3-5-18(9-11)13(14)20/h6,8,11H,3-5,7,9H2,1-2H3,(H2,14,20)/t11-/m0/s1.
What are the key properties of (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide?
(3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide has a molecular weight of 279.34 g/mol, XLogP of 0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-N-methyl-3-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1,3-dicarboxamide is sourced from PubChem (CID 32602078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).