C22H39N3O2S — CID 3260446
N-butyl-2-[[butyl(3,5,5-trimethylhexanoyl)amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 3260446) has the molecular formula C22H39N3O2S and a molecular weight of 409.64 g/mol. Its IUPAC name is N-butyl-2-[[butyl(3,5,5-trimethylhexanoyl)amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-[[butyl(3,5,5-trimethylhexanoyl)amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3260446 |
| Molecular Formula | C22H39N3O2S |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | N-butyl-2-[[butyl(3,5,5-trimethylhexanoyl)amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(CN(CCCC)C(=O)CC(C)CC(C)(C)C)n1 |
| InChI | InChI=1S/C22H39N3O2S/c1-7-9-11-23-21(27)18-16-28-19(24-18)15-25(12-10-8-2)20(26)13-17(3)14-22(4,5)6/h16-17H,7-15H2,1-6H3,(H,23,27) |
| InChIKey | CWZCPFZXAFETCJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|