C18H15ClN4O2S — CID 3261457
3-(2-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 3261457) has the molecular formula C18H15ClN4O2S and a molecular weight of 386.86 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 3-(2-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 3261457 |
| Molecular Formula | C18H15ClN4O2S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3-(2-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | COc1ccc(C2=Nn3c(nnc3-c3ccccc3Cl)SC2)cc1OC |
| InChI | InChI=1S/C18H15ClN4O2S/c1-24-15-8-7-11(9-16(15)25-2)14-10-26-18-21-20-17(23(18)22-14)12-5-3-4-6-13(12)19/h3-9H,10H2,1-2H3 |
| InChIKey | VFFSGFQGWMACSU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |