C13H21N3O3 — CID 32616717
1-(2-methoxyethyl)-N-[(2R)-3-methylbutan-2-yl]-6-oxopyridazine-3-carboxamide (PubChem CID 32616717) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-[(2R)-3-methylbutan-2-yl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-N-[(2R)-3-methylbutan-2-yl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 32616717 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-(2-methoxyethyl)-N-[(2R)-3-methylbutan-2-yl]-6-oxopyridazine-3-carboxamide |
| SMILES | COCCn1nc(C(=O)N[C@H](C)C(C)C)ccc1=O |
| InChI | InChI=1S/C13H21N3O3/c1-9(2)10(3)14-13(18)11-5-6-12(17)16(15-11)7-8-19-4/h5-6,9-10H,7-8H2,1-4H3,(H,14,18)/t10-/m1/s1 |
| InChIKey | CZNAZIYTBCRFFJ-SNVBAGLBSA-N |
| XLogP | 0.66 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |