C48H46F5NO6 — CID 3261756
naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate (PubChem CID 3261756) has the molecular formula C48H46F5NO6 and a molecular weight of 827.89 g/mol. Its IUPAC name is naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate.
| Compound Name | naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 3261756 |
| Molecular Formula | C48H46F5NO6 |
| Molecular Weight | 827.89 g/mol |
| Exact Mass | 827.32 |
| IUPAC Name | naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccc(OC(F)(F)F)cc2)C(=O)Oc2ccc3ccccc3c2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C48H46F5NO6/c1-30-6-5-22-46(2)41(39-19-12-32(24-36(55)15-9-30)25-40(39)44(56)35-14-20-42(49)43(50)27-35)21-23-47(46,58)29-54(28-31-10-16-37(17-11-31)60-48(51,52)53)45(57)59-38-18-13-33-7-3-4-8-34(33)26-38/h3-4,6-8,10-14,16-20,25-27,36,41,55,58H,5,9,15,21-24,28-29H2,1-2H3 |
| InChIKey | WVLYWNKCLYWSIT-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.89 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|