C28H25Br2N3O2 — CID 3264239
(5,7-dibromoquinolin-8-yl) 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate (PubChem CID 3264239) has the molecular formula C28H25Br2N3O2 and a molecular weight of 595.34 g/mol. Its IUPAC name is (5,7-dibromoquinolin-8-yl) 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate.
| Compound Name | (5,7-dibromoquinolin-8-yl) 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 3264239 |
| Molecular Formula | C28H25Br2N3O2 |
| Molecular Weight | 595.34 g/mol |
| Exact Mass | 593.03 |
| IUPAC Name | (5,7-dibromoquinolin-8-yl) 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate |
| SMILES | Cc1cc2nc3c(nc2cc1C)C1(C(=O)Oc2c(Br)cc(Br)c4cccnc24)CCC3(C)C1(C)C |
| InChI | InChI=1S/C28H25Br2N3O2/c1-14-11-19-20(12-15(14)2)33-24-23(32-19)27(5)8-9-28(24,26(27,3)4)25(34)35-22-18(30)13-17(29)16-7-6-10-31-21(16)22/h6-7,10-13H,8-9H2,1-5H3 |
| InChIKey | HRPHUOGJGHYMPT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.34 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|