C16H18ClF3N4O2 — CID 32643192
(3S)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 32643192) has the molecular formula C16H18ClF3N4O2 and a molecular weight of 390.79 g/mol. Its IUPAC name is (3S)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 32643192 |
| Molecular Formula | C16H18ClF3N4O2 |
| Molecular Weight | 390.79 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (3S)-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCNc1ncc(C(F)(F)F)cc1Cl)[C@H]1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C16H18ClF3N4O2/c17-12-6-10(16(18,19)20)7-23-14(12)21-3-4-22-15(26)9-5-13(25)24(8-9)11-1-2-11/h6-7,9,11H,1-5,8H2,(H,21,23)(H,22,26)/t9-/m0/s1 |
| InChIKey | ABCQBIYTWFZGRL-VIFPVBQESA-N |
| XLogP | 2.29 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|