C16H25NO4 — CID 32646107
N-hexyl-2,4,5-trimethoxybenzamide (PubChem CID 32646107) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-hexyl-2,4,5-trimethoxybenzamide.
| Compound Name | N-hexyl-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 32646107 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-hexyl-2,4,5-trimethoxybenzamide |
| SMILES | CCCCCCNC(=O)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C16H25NO4/c1-5-6-7-8-9-17-16(18)12-10-14(20-3)15(21-4)11-13(12)19-2/h10-11H,5-9H2,1-4H3,(H,17,18) |
| InChIKey | XRAYGPQKPINEOW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|