C24H22N6O2 — CID 32646472
2-methyl-3-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)phenyl]quinazolin-4-one (PubChem CID 32646472) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-methyl-3-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)phenyl]quinazolin-4-one.
| Compound Name | 2-methyl-3-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 32646472 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-methyl-3-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)phenyl]quinazolin-4-one |
| SMILES | Cc1nc2ccccc2c(=O)n1-c1ccc(C(=O)N2CCN(c3cnccn3)CC2)cc1 |
| InChI | InChI=1S/C24H22N6O2/c1-17-27-21-5-3-2-4-20(21)24(32)30(17)19-8-6-18(7-9-19)23(31)29-14-12-28(13-15-29)22-16-25-10-11-26-22/h2-11,16H,12-15H2,1H3 |
| InChIKey | UQCBUFJUPWTTAU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |