C18H23ClFN3O — CID 32647072
5-chloro-1-[(4-fluorophenyl)methyl]-N-hexyl-3-methylpyrazole-4-carboxamide (PubChem CID 32647072) has the molecular formula C18H23ClFN3O and a molecular weight of 351.85 g/mol. Its IUPAC name is 5-chloro-1-[(4-fluorophenyl)methyl]-N-hexyl-3-methylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-1-[(4-fluorophenyl)methyl]-N-hexyl-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 32647072 |
| Molecular Formula | C18H23ClFN3O |
| Molecular Weight | 351.85 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 5-chloro-1-[(4-fluorophenyl)methyl]-N-hexyl-3-methylpyrazole-4-carboxamide |
| SMILES | CCCCCCNC(=O)c1c(C)nn(Cc2ccc(F)cc2)c1Cl |
| InChI | InChI=1S/C18H23ClFN3O/c1-3-4-5-6-11-21-18(24)16-13(2)22-23(17(16)19)12-14-7-9-15(20)10-8-14/h7-10H,3-6,11-12H2,1-2H3,(H,21,24) |
| InChIKey | AEDLMAZSUHTSRO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|