C18H15FN4O2S — CID 3264774
propan-2-yl 4-(3-fluorophenyl)-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate (PubChem CID 3264774) has the molecular formula C18H15FN4O2S and a molecular weight of 370.41 g/mol. Its IUPAC name is propan-2-yl 4-(3-fluorophenyl)-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate.
| Compound Name | propan-2-yl 4-(3-fluorophenyl)-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 3264774 |
| Molecular Formula | C18H15FN4O2S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | propan-2-yl 4-(3-fluorophenyl)-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)sc2ncn3nc(-c4cccc(F)c4)nc3c12 |
| InChI | InChI=1S/C18H15FN4O2S/c1-9(2)25-18(24)14-10(3)13-16-21-15(11-5-4-6-12(19)7-11)22-23(16)8-20-17(13)26-14/h4-9H,1-3H3 |
| InChIKey | JOSGFDJIZPRGQV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |