About 4,7-dimethyl-1H-indole-2,3-dione
4,7-dimethyl-1H-indole-2,3-dione (PubChem CID 3264931) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 4,7-dimethyl-1H-indole-2,3-dione.
Molecular Properties
| Compound Name | 4,7-dimethyl-1H-indole-2,3-dione |
| PubChem CID | 3264931 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 4,7-dimethyl-1H-indole-2,3-dione |
| SMILES | Cc1ccc(C)c2c1NC(=O)C2=O |
| InChI | InChI=1S/C10H9NO2/c1-5-3-4-6(2)8-7(5)9(12)10(13)11-8/h3-4H,1-2H3,(H,11,12,13) |
| InChIKey | VYRDPBOVRAVNKT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dimethyl-1H-indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-1H-indole-2,3-dione?
The IUPAC name of 4,7-dimethyl-1H-indole-2,3-dione (CID 3264931) is 4,7-dimethyl-1H-indole-2,3-dione.
What is the SMILES notation for 4,7-dimethyl-1H-indole-2,3-dione?
The canonical SMILES for 4,7-dimethyl-1H-indole-2,3-dione is Cc1ccc(C)c2c1NC(=O)C2=O.
What is the InChIKey of 4,7-dimethyl-1H-indole-2,3-dione?
The InChIKey is VYRDPBOVRAVNKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-5-3-4-6(2)8-7(5)9(12)10(13)11-8/h3-4H,1-2H3,(H,11,12,13).
What are the key properties of 4,7-dimethyl-1H-indole-2,3-dione?
4,7-dimethyl-1H-indole-2,3-dione has a molecular weight of 175.19 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-1H-indole-2,3-dione is sourced from PubChem (CID 3264931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).