C10H9NO2 — CID 3264931
4,7-dimethyl-1H-indole-2,3-dione (PubChem CID 3264931) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 4,7-dimethyl-1H-indole-2,3-dione.
| Compound Name | 4,7-dimethyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 3264931 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 4,7-dimethyl-1H-indole-2,3-dione |
| SMILES | Cc1ccc(C)c2c1NC(=O)C2=O |
| InChI | InChI=1S/C10H9NO2/c1-5-3-4-6(2)8-7(5)9(12)10(13)11-8/h3-4H,1-2H3,(H,11,12,13) |
| InChIKey | VYRDPBOVRAVNKT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|