About (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate
(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate (PubChem CID 3265032) has the molecular formula C14H12N4O3
and a molecular weight of 284.28 g/mol. Its IUPAC name is (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate.
Molecular Properties
| Compound Name | (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate |
| PubChem CID | 3265032 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cc(C)nn3cnnc23)cc1 |
| InChI | InChI=1S/C14H12N4O3/c1-9-7-12(13-16-15-8-18(13)17-9)21-14(19)10-3-5-11(20-2)6-4-10/h3-8H,1-2H3 |
| InChIKey | TZNSQCSCCALZRS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate?
The IUPAC name of (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate (CID 3265032) is (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate.
What is the SMILES notation for (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate?
The canonical SMILES for (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate is COc1ccc(C(=O)Oc2cc(C)nn3cnnc23)cc1.
What is the InChIKey of (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate?
The InChIKey is TZNSQCSCCALZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O3/c1-9-7-12(13-16-15-8-18(13)17-9)21-14(19)10-3-5-11(20-2)6-4-10/h3-8H,1-2H3.
What are the key properties of (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate?
(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate has a molecular weight of 284.28 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl) 4-methoxybenzoate is sourced from PubChem (CID 3265032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).