C16H8F7N3O — CID 3265721
2-[2-[[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetonitrile (PubChem CID 3265721) has the molecular formula C16H8F7N3O and a molecular weight of 391.25 g/mol. Its IUPAC name is 2-[2-[[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-[[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 3265721 |
| Molecular Formula | C16H8F7N3O |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-[2-[[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccccc1C=NNc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C16H8F7N3O/c17-11-10(16(21,22)23)12(18)14(20)15(13(11)19)26-25-7-8-3-1-2-4-9(8)27-6-5-24/h1-4,7,26H,6H2 |
| InChIKey | KJXQTARERORJMT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|