C32H29N3O2 — CID 3265806
[4-(4-cyanophenyl)phenyl] 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate (PubChem CID 3265806) has the molecular formula C32H29N3O2 and a molecular weight of 487.60 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 3265806 |
| Molecular Formula | C32H29N3O2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate |
| SMILES | Cc1cc2nc3c(nc2cc1C)C1(C(=O)Oc2ccc(-c4ccc(C#N)cc4)cc2)CCC3(C)C1(C)C |
| InChI | InChI=1S/C32H29N3O2/c1-19-16-25-26(17-20(19)2)35-28-27(34-25)31(5)14-15-32(28,30(31,3)4)29(36)37-24-12-10-23(11-13-24)22-8-6-21(18-33)7-9-22/h6-13,16-17H,14-15H2,1-5H3 |
| InChIKey | ANNADRGDAIFMBO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|