About 2,3-dihydro-1,3-benzothiazole-2-thiol
2,3-dihydro-1,3-benzothiazole-2-thiol (PubChem CID 3266369) has the molecular formula C7H7NS2
and a molecular weight of 169.27 g/mol. Its IUPAC name is 2,3-dihydro-1,3-benzothiazole-2-thiol.
Molecular Properties
| Compound Name | 2,3-dihydro-1,3-benzothiazole-2-thiol |
| PubChem CID | 3266369 |
| Molecular Formula | C7H7NS2 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | 2,3-dihydro-1,3-benzothiazole-2-thiol |
| SMILES | SC1Nc2ccccc2S1 |
| InChI | InChI=1S/C7H7NS2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4,7-9H |
| InChIKey | PYVUUPVBIDIYPY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1,3-benzothiazole-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,3-benzothiazole-2-thiol?
The IUPAC name of 2,3-dihydro-1,3-benzothiazole-2-thiol (CID 3266369) is 2,3-dihydro-1,3-benzothiazole-2-thiol.
What is the SMILES notation for 2,3-dihydro-1,3-benzothiazole-2-thiol?
The canonical SMILES for 2,3-dihydro-1,3-benzothiazole-2-thiol is SC1Nc2ccccc2S1.
What is the InChIKey of 2,3-dihydro-1,3-benzothiazole-2-thiol?
The InChIKey is PYVUUPVBIDIYPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4,7-9H.
What are the key properties of 2,3-dihydro-1,3-benzothiazole-2-thiol?
2,3-dihydro-1,3-benzothiazole-2-thiol has a molecular weight of 169.27 g/mol, XLogP of 2.42, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,3-benzothiazole-2-thiol is sourced from PubChem (CID 3266369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).