C20H21N3O2S3 — CID 3266582
N-(7-methyl-4-oxo-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 3266582) has the molecular formula C20H21N3O2S3 and a molecular weight of 431.61 g/mol. Its IUPAC name is N-(7-methyl-4-oxo-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(7-methyl-4-oxo-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 3266582 |
| Molecular Formula | C20H21N3O2S3 |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-(7-methyl-4-oxo-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1CCc2c(sc3[nH]c(=S)n(NC(=O)c4csc5c4CCCC5)c(=O)c23)C1 |
| InChI | InChI=1S/C20H21N3O2S3/c1-10-6-7-12-15(8-10)28-18-16(12)19(25)23(20(26)21-18)22-17(24)13-9-27-14-5-3-2-4-11(13)14/h9-10H,2-8H2,1H3,(H,21,26)(H,22,24) |
| InChIKey | MXCGRUDGJGSMDU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|