C17H18N4O2S2 — CID 32669188
N-cyclopropyl-N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 32669188) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-cyclopropyl-N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 32669188 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-cyclopropyl-N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)N(c1nnc(SCC(=O)N2CCc3ccccc32)s1)C1CC1 |
| InChI | InChI=1S/C17H18N4O2S2/c1-11(22)21(13-6-7-13)16-18-19-17(25-16)24-10-15(23)20-9-8-12-4-2-3-5-14(12)20/h2-5,13H,6-10H2,1H3 |
| InChIKey | LOACWYYTQHJHPH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|