C19H19ClN2O3 — CID 3267583
N-benzyl-2-(6-chloro-2-ethyl-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 3267583) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-benzyl-2-(6-chloro-2-ethyl-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-benzyl-2-(6-chloro-2-ethyl-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 3267583 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-benzyl-2-(6-chloro-2-ethyl-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | CCC1Oc2ccc(Cl)cc2N(CC(=O)NCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H19ClN2O3/c1-2-16-19(24)22(15-10-14(20)8-9-17(15)25-16)12-18(23)21-11-13-6-4-3-5-7-13/h3-10,16H,2,11-12H2,1H3,(H,21,23) |
| InChIKey | ARFXWGLMNGWLSU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |