C19H17N5 — CID 32678340
N-benzhydryl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 32678340) has the molecular formula C19H17N5 and a molecular weight of 315.38 g/mol. Its IUPAC name is N-benzhydryl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-benzhydryl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 32678340 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-benzhydryl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NC(c2ccccc2)c2ccccc2)n2ncnc2n1 |
| InChI | InChI=1S/C19H17N5/c1-14-12-17(24-19(22-14)20-13-21-24)23-18(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-13,18,23H,1H3 |
| InChIKey | BRSXDXJWBMLSSX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |