C16H19N5S — CID 32680974
5-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 32680974) has the molecular formula C16H19N5S and a molecular weight of 313.43 g/mol. Its IUPAC name is 5-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 32680974 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 5-methyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1ccc(CSCCNc2cc(C)nc3ncnn23)cc1 |
| InChI | InChI=1S/C16H19N5S/c1-12-3-5-14(6-4-12)10-22-8-7-17-15-9-13(2)20-16-18-11-19-21(15)16/h3-6,9,11,17H,7-8,10H2,1-2H3 |
| InChIKey | NSZVXPVHGZOXOJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|