About N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide
N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide (PubChem CID 3268184) has the molecular formula C21H19N5O2S
and a molecular weight of 405.48 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide |
| PubChem CID | 3268184 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(/N=C/c3c[nH]c4ccccc34)cc2)n1 |
| InChI | InChI=1S/C21H19N5O2S/c1-14-11-15(2)25-21(24-14)26-29(27,28)18-9-7-17(8-10-18)22-12-16-13-23-20-6-4-3-5-19(16)20/h3-13,23H,1-2H3,(H,24,25,26)/b22-12+ |
| InChIKey | UPZWWUFCNQRMOY-WSDLNYQXSA-N |
| XLogP | 4.13 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide?
The IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide (CID 3268184) is N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide.
What is the SMILES notation for N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide?
The canonical SMILES for N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide is Cc1cc(C)nc(NS(=O)(=O)c2ccc(/N=C/c3c[nH]c4ccccc34)cc2)n1.
What is the InChIKey of N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide?
The InChIKey is UPZWWUFCNQRMOY-WSDLNYQXSA-N. The full InChI is InChI=1S/C21H19N5O2S/c1-14-11-15(2)25-21(24-14)26-29(27,28)18-9-7-17(8-10-18)22-12-16-13-23-20-6-4-3-5-19(16)20/h3-13,23H,1-2H3,(H,24,25,26)/b22-12+.
What are the key properties of N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide?
N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide has a molecular weight of 405.48 g/mol, XLogP of 4.13, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethylpyrimidin-2-yl)-4-(1H-indol-3-ylmethylideneamino)benzenesulfonamide is sourced from PubChem (CID 3268184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).