C21H24N2O4 — CID 3268615
N-(2-phenoxyphenyl)-1,5-dioxa-9-azaspiro[5.5]undecane-9-carboxamide (PubChem CID 3268615) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-(2-phenoxyphenyl)-1,5-dioxa-9-azaspiro[5.5]undecane-9-carboxamide.
| Compound Name | N-(2-phenoxyphenyl)-1,5-dioxa-9-azaspiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 3268615 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-(2-phenoxyphenyl)-1,5-dioxa-9-azaspiro[5.5]undecane-9-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)N1CCC2(CC1)OCCCO2 |
| InChI | InChI=1S/C21H24N2O4/c24-20(23-13-11-21(12-14-23)25-15-6-16-26-21)22-18-9-4-5-10-19(18)27-17-7-2-1-3-8-17/h1-5,7-10H,6,11-16H2,(H,22,24) |
| InChIKey | DUQXWXCVKVVFDS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |