About ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate
ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate (PubChem CID 3269152) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate |
| PubChem CID | 3269152 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(COC(C)=O)c(CC)c1CC |
| InChI | InChI=1S/C14H21NO4/c1-5-10-11(6-2)13(14(17)18-7-3)15-12(10)8-19-9(4)16/h15H,5-8H2,1-4H3 |
| InChIKey | NWWVJPLXYSQQHR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate?
The IUPAC name of ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate (CID 3269152) is ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate?
The canonical SMILES for ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate is CCOC(=O)c1[nH]c(COC(C)=O)c(CC)c1CC.
What is the InChIKey of ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate?
The InChIKey is NWWVJPLXYSQQHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-5-10-11(6-2)13(14(17)18-7-3)15-12(10)8-19-9(4)16/h15H,5-8H2,1-4H3.
What are the key properties of ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate?
ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate has a molecular weight of 267.32 g/mol, XLogP of 2.38, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(acetyloxymethyl)-3,4-diethyl-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 3269152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).