C25H23N3O4 — CID 3269211
2-[11-(3,4-dimethoxyphenyl)-13-imino-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-14-yl]ethanol (PubChem CID 3269211) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-[11-(3,4-dimethoxyphenyl)-13-imino-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-14-yl]ethanol.
| Compound Name | 2-[11-(3,4-dimethoxyphenyl)-13-imino-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-14-yl]ethanol |
|---|---|
| PubChem CID | 3269211 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-[11-(3,4-dimethoxyphenyl)-13-imino-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-14-yl]ethanol |
| SMILES | [H]/N=c1/c2c(ncn1CCO)Oc1c(ccc3ccccc13)C2c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H23N3O4/c1-30-19-10-8-16(13-20(19)31-2)21-18-9-7-15-5-3-4-6-17(15)23(18)32-25-22(21)24(26)28(11-12-29)14-27-25/h3-10,13-14,21,26,29H,11-12H2,1-2H3/b26-24- |
| InChIKey | IQKLXXPMDIELJF-LCUIJRPUSA-N |
| XLogP | 3.81 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |