C17H15N3O3S — CID 3269479
4-(1,3-benzodioxol-5-yl)-6-(3-cyanopropylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 3269479) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-6-(3-cyanopropylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-6-(3-cyanopropylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 3269479 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-6-(3-cyanopropylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | N#CCCCSC1=C(C#N)C(c2ccc3c(c2)OCO3)CC(=O)N1 |
| InChI | InChI=1S/C17H15N3O3S/c18-5-1-2-6-24-17-13(9-19)12(8-16(21)20-17)11-3-4-14-15(7-11)23-10-22-14/h3-4,7,12H,1-2,6,8,10H2,(H,20,21) |
| InChIKey | BDJUISHDLMCKIZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|