About (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol
(2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol (PubChem CID 32695207) has the molecular formula C17H16N4OS2
and a molecular weight of 356.48 g/mol. Its IUPAC name is (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol |
| PubChem CID | 32695207 |
| Molecular Formula | C17H16N4OS2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol |
| SMILES | Nc1nnc(SC[C@@H](O)Cn2c3ccccc3c3ccccc32)s1 |
| InChI | InChI=1S/C17H16N4OS2/c18-16-19-20-17(24-16)23-10-11(22)9-21-14-7-3-1-5-12(14)13-6-2-4-8-15(13)21/h1-8,11,22H,9-10H2,(H2,18,19)/t11-/m0/s1 |
| InChIKey | APPRMFWTQZRABG-NSHDSACASA-N |
| XLogP | 3.38 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol?
The IUPAC name of (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol (CID 32695207) is (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol.
What is the SMILES notation for (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol?
The canonical SMILES for (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol is Nc1nnc(SC[C@@H](O)Cn2c3ccccc3c3ccccc32)s1.
What is the InChIKey of (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol?
The InChIKey is APPRMFWTQZRABG-NSHDSACASA-N. The full InChI is InChI=1S/C17H16N4OS2/c18-16-19-20-17(24-16)23-10-11(22)9-21-14-7-3-1-5-12(14)13-6-2-4-8-15(13)21/h1-8,11,22H,9-10H2,(H2,18,19)/t11-/m0/s1.
What are the key properties of (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol?
(2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol has a molecular weight of 356.48 g/mol, XLogP of 3.38, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-3-carbazol-9-ylpropan-2-ol is sourced from PubChem (CID 32695207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).