C17H17F4NO — CID 3269571
N-(1-adamantyl)-2,3,4,5-tetrafluorobenzamide (PubChem CID 3269571) has the molecular formula C17H17F4NO and a molecular weight of 327.32 g/mol. Its IUPAC name is N-(1-adamantyl)-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-(1-adamantyl)-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 3269571 |
| Molecular Formula | C17H17F4NO |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(1-adamantyl)-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H17F4NO/c18-12-4-11(13(19)15(21)14(12)20)16(23)22-17-5-8-1-9(6-17)3-10(2-8)7-17/h4,8-10H,1-3,5-7H2,(H,22,23) |
| InChIKey | PYYCGLZGQQXDCS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|